C9H10Cl2O — CID 130952476
2-(3,5-dichlorophenyl)propan-1-ol (PubChem CID 130952476) has the molecular formula C9H10Cl2O and a molecular weight of 205.08 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)propan-1-ol.
| Compound Name | 2-(3,5-dichlorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 130952476 |
| Molecular Formula | C9H10Cl2O |
| Molecular Weight | 205.08 g/mol |
| Exact Mass | 204.01 |
| IUPAC Name | 2-(3,5-dichlorophenyl)propan-1-ol |
| SMILES | CC(CO)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2O/c1-6(5-12)7-2-8(10)4-9(11)3-7/h2-4,6,12H,5H2,1H3 |
| InChIKey | ZCRWBSDLNVXYJS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.08 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |