C14H8F6 — CID 90465484
1,2,3-trifluoro-5-[1-(3,4,5-trifluorophenyl)ethyl]benzene (PubChem CID 90465484) has the molecular formula C14H8F6 and a molecular weight of 290.21 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[1-(3,4,5-trifluorophenyl)ethyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[1-(3,4,5-trifluorophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 90465484 |
| Molecular Formula | C14H8F6 |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1,2,3-trifluoro-5-[1-(3,4,5-trifluorophenyl)ethyl]benzene |
| SMILES | CC(c1cc(F)c(F)c(F)c1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H8F6/c1-6(7-2-9(15)13(19)10(16)3-7)8-4-11(17)14(20)12(18)5-8/h2-6H,1H3 |
| InChIKey | ZZHCCUDANVGLFY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|