C12H12F3N — CID 115897017
N-[1-(3,4,5-trifluorophenyl)ethyl]but-2-yn-1-amine (PubChem CID 115897017) has the molecular formula C12H12F3N and a molecular weight of 227.23 g/mol. Its IUPAC name is N-[1-(3,4,5-trifluorophenyl)ethyl]but-2-yn-1-amine.
| Compound Name | N-[1-(3,4,5-trifluorophenyl)ethyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 115897017 |
| Molecular Formula | C12H12F3N |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-[1-(3,4,5-trifluorophenyl)ethyl]but-2-yn-1-amine |
| SMILES | CC#CCNC(C)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H12F3N/c1-3-4-5-16-8(2)9-6-10(13)12(15)11(14)7-9/h6-8,16H,5H2,1-2H3 |
| InChIKey | IPTFFTSUWQZSAD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|