C14H24N2 — CID 117107326
5-(4-aminobutan-2-yl)-N,N,2,3-tetramethylaniline (PubChem CID 117107326) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 5-(4-aminobutan-2-yl)-N,N,2,3-tetramethylaniline.
| Compound Name | 5-(4-aminobutan-2-yl)-N,N,2,3-tetramethylaniline |
|---|---|
| PubChem CID | 117107326 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 5-(4-aminobutan-2-yl)-N,N,2,3-tetramethylaniline |
| SMILES | Cc1cc(C(C)CCN)cc(N(C)C)c1C |
| InChI | InChI=1S/C14H24N2/c1-10(6-7-15)13-8-11(2)12(3)14(9-13)16(4)5/h8-10H,6-7,15H2,1-5H3 |
| InChIKey | WHDLNJXMGFSBLY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |