C8H6F4O2 — CID 130934755
[2-(difluoromethoxy)-4,6-difluorophenyl]methanol (PubChem CID 130934755) has the molecular formula C8H6F4O2 and a molecular weight of 210.13 g/mol. Its IUPAC name is [2-(difluoromethoxy)-4,6-difluorophenyl]methanol.
| Compound Name | [2-(difluoromethoxy)-4,6-difluorophenyl]methanol |
|---|---|
| PubChem CID | 130934755 |
| Molecular Formula | C8H6F4O2 |
| Molecular Weight | 210.13 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | [2-(difluoromethoxy)-4,6-difluorophenyl]methanol |
| SMILES | OCc1c(F)cc(F)cc1OC(F)F |
| InChI | InChI=1S/C8H6F4O2/c9-4-1-6(10)5(3-13)7(2-4)14-8(11)12/h1-2,8,13H,3H2 |
| InChIKey | CQHXGBVXLLPZCW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.13 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |