C7H5BF4O3 — CID 171030320
[3-(difluoromethoxy)-2,5-difluorophenyl]boronic acid (PubChem CID 171030320) has the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. Its IUPAC name is [3-(difluoromethoxy)-2,5-difluorophenyl]boronic acid.
| Compound Name | [3-(difluoromethoxy)-2,5-difluorophenyl]boronic acid |
|---|---|
| PubChem CID | 171030320 |
| Molecular Formula | C7H5BF4O3 |
| Molecular Weight | 223.92 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | [3-(difluoromethoxy)-2,5-difluorophenyl]boronic acid |
| SMILES | OB(O)c1cc(F)cc(OC(F)F)c1F |
| InChI | InChI=1S/C7H5BF4O3/c9-3-1-4(8(13)14)6(10)5(2-3)15-7(11)12/h1-2,7,13-14H |
| InChIKey | DNTPJFVDGQSINO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.92 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|