C10H6F3NO3 — CID 119017382
2-[2-cyano-3-(difluoromethoxy)-5-fluorophenyl]acetic acid (PubChem CID 119017382) has the molecular formula C10H6F3NO3 and a molecular weight of 245.16 g/mol. Its IUPAC name is 2-[2-cyano-3-(difluoromethoxy)-5-fluorophenyl]acetic acid.
| Compound Name | 2-[2-cyano-3-(difluoromethoxy)-5-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 119017382 |
| Molecular Formula | C10H6F3NO3 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 2-[2-cyano-3-(difluoromethoxy)-5-fluorophenyl]acetic acid |
| SMILES | N#Cc1c(CC(=O)O)cc(F)cc1OC(F)F |
| InChI | InChI=1S/C10H6F3NO3/c11-6-1-5(2-9(15)16)7(4-14)8(3-6)17-10(12)13/h1,3,10H,2H2,(H,15,16) |
| InChIKey | LHLKSINHENTSTF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |