C11H9F2NO4 — CID 118827849
2-[4-cyano-2-(difluoromethoxy)-5-methoxyphenyl]acetic acid (PubChem CID 118827849) has the molecular formula C11H9F2NO4 and a molecular weight of 257.19 g/mol. Its IUPAC name is 2-[4-cyano-2-(difluoromethoxy)-5-methoxyphenyl]acetic acid.
| Compound Name | 2-[4-cyano-2-(difluoromethoxy)-5-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 118827849 |
| Molecular Formula | C11H9F2NO4 |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-[4-cyano-2-(difluoromethoxy)-5-methoxyphenyl]acetic acid |
| SMILES | COc1cc(CC(=O)O)c(OC(F)F)cc1C#N |
| InChI | InChI=1S/C11H9F2NO4/c1-17-8-2-6(4-10(15)16)9(18-11(12)13)3-7(8)5-14/h2-3,11H,4H2,1H3,(H,15,16) |
| InChIKey | OVWJEKAOOULCHN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |