C13H14F2N2O3 — CID 134652186
ethyl 2-[5-(aminomethyl)-4-cyano-2-(difluoromethoxy)phenyl]acetate (PubChem CID 134652186) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is ethyl 2-[5-(aminomethyl)-4-cyano-2-(difluoromethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[5-(aminomethyl)-4-cyano-2-(difluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 134652186 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | ethyl 2-[5-(aminomethyl)-4-cyano-2-(difluoromethoxy)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(CN)c(C#N)cc1OC(F)F |
| InChI | InChI=1S/C13H14F2N2O3/c1-2-19-12(18)5-8-3-9(6-16)10(7-17)4-11(8)20-13(14)15/h3-4,13H,2,5-6,16H2,1H3 |
| InChIKey | BPUYOQVTSLLCFD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |