C12H10F3NO3 — CID 134653787
ethyl 2-[5-cyano-4-(difluoromethoxy)-2-fluorophenyl]acetate (PubChem CID 134653787) has the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. Its IUPAC name is ethyl 2-[5-cyano-4-(difluoromethoxy)-2-fluorophenyl]acetate.
| Compound Name | ethyl 2-[5-cyano-4-(difluoromethoxy)-2-fluorophenyl]acetate |
|---|---|
| PubChem CID | 134653787 |
| Molecular Formula | C12H10F3NO3 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | ethyl 2-[5-cyano-4-(difluoromethoxy)-2-fluorophenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C#N)c(OC(F)F)cc1F |
| InChI | InChI=1S/C12H10F3NO3/c1-2-18-11(17)4-7-3-8(6-16)10(5-9(7)13)19-12(14)15/h3,5,12H,2,4H2,1H3 |
| InChIKey | VREKEKHVRGLVMD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |