C12H11F2NO3S — CID 134640416
ethyl 2-[2-cyano-4-(difluoromethoxy)-5-sulfanylphenyl]acetate (PubChem CID 134640416) has the molecular formula C12H11F2NO3S and a molecular weight of 287.29 g/mol. Its IUPAC name is ethyl 2-[2-cyano-4-(difluoromethoxy)-5-sulfanylphenyl]acetate.
| Compound Name | ethyl 2-[2-cyano-4-(difluoromethoxy)-5-sulfanylphenyl]acetate |
|---|---|
| PubChem CID | 134640416 |
| Molecular Formula | C12H11F2NO3S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | ethyl 2-[2-cyano-4-(difluoromethoxy)-5-sulfanylphenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(S)c(OC(F)F)cc1C#N |
| InChI | InChI=1S/C12H11F2NO3S/c1-2-17-11(16)5-7-4-10(19)9(18-12(13)14)3-8(7)6-15/h3-4,12,19H,2,5H2,1H3 |
| InChIKey | FCDMCZDJFALPDI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|