C13H11F2NO4 — CID 134653807
ethyl 2-[4-cyano-5-(difluoromethoxy)-2-formylphenyl]acetate (PubChem CID 134653807) has the molecular formula C13H11F2NO4 and a molecular weight of 283.23 g/mol. Its IUPAC name is ethyl 2-[4-cyano-5-(difluoromethoxy)-2-formylphenyl]acetate.
| Compound Name | ethyl 2-[4-cyano-5-(difluoromethoxy)-2-formylphenyl]acetate |
|---|---|
| PubChem CID | 134653807 |
| Molecular Formula | C13H11F2NO4 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | ethyl 2-[4-cyano-5-(difluoromethoxy)-2-formylphenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(OC(F)F)c(C#N)cc1C=O |
| InChI | InChI=1S/C13H11F2NO4/c1-2-19-12(18)5-8-4-11(20-13(14)15)9(6-16)3-10(8)7-17/h3-4,7,13H,2,5H2,1H3 |
| InChIKey | FRFSOHBOTSDPGD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|