C13H11F2NO3 — CID 134654019
ethyl 2-[4-cyano-2-(difluoromethyl)-5-formylphenyl]acetate (PubChem CID 134654019) has the molecular formula C13H11F2NO3 and a molecular weight of 267.23 g/mol. Its IUPAC name is ethyl 2-[4-cyano-2-(difluoromethyl)-5-formylphenyl]acetate.
| Compound Name | ethyl 2-[4-cyano-2-(difluoromethyl)-5-formylphenyl]acetate |
|---|---|
| PubChem CID | 134654019 |
| Molecular Formula | C13H11F2NO3 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | ethyl 2-[4-cyano-2-(difluoromethyl)-5-formylphenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C=O)c(C#N)cc1C(F)F |
| InChI | InChI=1S/C13H11F2NO3/c1-2-19-12(18)5-8-3-10(7-17)9(6-16)4-11(8)13(14)15/h3-4,7,13H,2,5H2,1H3 |
| InChIKey | JWCCMUBFPYRQGW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|