C13H10F5NO2S — CID 134655230
ethyl 2-[5-cyano-2-(difluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 134655230) has the molecular formula C13H10F5NO2S and a molecular weight of 339.29 g/mol. Its IUPAC name is ethyl 2-[5-cyano-2-(difluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | ethyl 2-[5-cyano-2-(difluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 134655230 |
| Molecular Formula | C13H10F5NO2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | ethyl 2-[5-cyano-2-(difluoromethyl)-4-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(C#N)c(SC(F)(F)F)cc1C(F)F |
| InChI | InChI=1S/C13H10F5NO2S/c1-2-21-11(20)4-7-3-8(6-19)10(22-13(16,17)18)5-9(7)12(14)15/h3,5,12H,2,4H2,1H3 |
| InChIKey | PIHYWDFDZNNRSB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |