C13H11BrF3NO2S — CID 134653026
ethyl 2-[4-(bromomethyl)-2-cyano-5-(trifluoromethylsulfanyl)phenyl]acetate (PubChem CID 134653026) has the molecular formula C13H11BrF3NO2S and a molecular weight of 382.20 g/mol. Its IUPAC name is ethyl 2-[4-(bromomethyl)-2-cyano-5-(trifluoromethylsulfanyl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(bromomethyl)-2-cyano-5-(trifluoromethylsulfanyl)phenyl]acetate |
|---|---|
| PubChem CID | 134653026 |
| Molecular Formula | C13H11BrF3NO2S |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | ethyl 2-[4-(bromomethyl)-2-cyano-5-(trifluoromethylsulfanyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(SC(F)(F)F)c(CBr)cc1C#N |
| InChI | InChI=1S/C13H11BrF3NO2S/c1-2-20-12(19)5-8-4-11(21-13(15,16)17)9(6-14)3-10(8)7-18/h3-4H,2,5-6H2,1H3 |
| InChIKey | QEXCTMOZWXHION-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|