C12H11F2NO4 — CID 134654612
ethyl 2-[2-cyano-3-(difluoromethoxy)-5-hydroxyphenyl]acetate (PubChem CID 134654612) has the molecular formula C12H11F2NO4 and a molecular weight of 271.22 g/mol. Its IUPAC name is ethyl 2-[2-cyano-3-(difluoromethoxy)-5-hydroxyphenyl]acetate.
| Compound Name | ethyl 2-[2-cyano-3-(difluoromethoxy)-5-hydroxyphenyl]acetate |
|---|---|
| PubChem CID | 134654612 |
| Molecular Formula | C12H11F2NO4 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | ethyl 2-[2-cyano-3-(difluoromethoxy)-5-hydroxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(O)cc(OC(F)F)c1C#N |
| InChI | InChI=1S/C12H11F2NO4/c1-2-18-11(17)4-7-3-8(16)5-10(9(7)6-15)19-12(13)14/h3,5,12,16H,2,4H2,1H3 |
| InChIKey | KRGYGCYOLLGZLA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |