C10H8F2N2O3 — CID 134651854
5-(aminomethyl)-4-cyano-2-(difluoromethoxy)benzoic acid (PubChem CID 134651854) has the molecular formula C10H8F2N2O3 and a molecular weight of 242.18 g/mol. Its IUPAC name is 5-(aminomethyl)-4-cyano-2-(difluoromethoxy)benzoic acid.
| Compound Name | 5-(aminomethyl)-4-cyano-2-(difluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 134651854 |
| Molecular Formula | C10H8F2N2O3 |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 5-(aminomethyl)-4-cyano-2-(difluoromethoxy)benzoic acid |
| SMILES | N#Cc1cc(OC(F)F)c(C(=O)O)cc1CN |
| InChI | InChI=1S/C10H8F2N2O3/c11-10(12)17-8-2-6(4-14)5(3-13)1-7(8)9(15)16/h1-2,10H,3,13H2,(H,15,16) |
| InChIKey | HBMHROHJYBNJOC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |