C11H6F5NO4 — CID 119018536
2-[2-cyano-3-(difluoromethoxy)-5-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 119018536) has the molecular formula C11H6F5NO4 and a molecular weight of 311.16 g/mol. Its IUPAC name is 2-[2-cyano-3-(difluoromethoxy)-5-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-[2-cyano-3-(difluoromethoxy)-5-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 119018536 |
| Molecular Formula | C11H6F5NO4 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 2-[2-cyano-3-(difluoromethoxy)-5-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | N#Cc1c(CC(=O)O)cc(OC(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C11H6F5NO4/c12-10(13)20-8-3-6(21-11(14,15)16)1-5(2-9(18)19)7(8)4-17/h1,3,10H,2H2,(H,18,19) |
| InChIKey | NOSWWZUOFKSPHY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |