C7H5Cl2FO — CID 118642652
(2,4-dichloro-6-fluorophenyl)methanol (PubChem CID 118642652) has the molecular formula C7H5Cl2FO and a molecular weight of 195.02 g/mol. Its IUPAC name is (2,4-dichloro-6-fluorophenyl)methanol.
| Compound Name | (2,4-dichloro-6-fluorophenyl)methanol |
|---|---|
| PubChem CID | 118642652 |
| Molecular Formula | C7H5Cl2FO |
| Molecular Weight | 195.02 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | (2,4-dichloro-6-fluorophenyl)methanol |
| SMILES | OCc1c(F)cc(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl2FO/c8-4-1-6(9)5(3-11)7(10)2-4/h1-2,11H,3H2 |
| InChIKey | LZUBSPAUXRAIST-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.02 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |