C7H4ClF3 — CID 130776716
5-chloro-1,3-difluoro-2-(fluoromethyl)benzene (PubChem CID 130776716) has the molecular formula C7H4ClF3 and a molecular weight of 180.56 g/mol. Its IUPAC name is 5-chloro-1,3-difluoro-2-(fluoromethyl)benzene.
| Compound Name | 5-chloro-1,3-difluoro-2-(fluoromethyl)benzene |
|---|---|
| PubChem CID | 130776716 |
| Molecular Formula | C7H4ClF3 |
| Molecular Weight | 180.56 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | 5-chloro-1,3-difluoro-2-(fluoromethyl)benzene |
| SMILES | FCc1c(F)cc(Cl)cc1F |
| InChI | InChI=1S/C7H4ClF3/c8-4-1-6(10)5(3-9)7(11)2-4/h1-2H,3H2 |
| InChIKey | LRYOWDCGVQZIRD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |