C10H12ClF2N — CID 130848043
1-(4-chloro-2,6-difluorophenyl)butan-2-amine (PubChem CID 130848043) has the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. Its IUPAC name is 1-(4-chloro-2,6-difluorophenyl)butan-2-amine.
| Compound Name | 1-(4-chloro-2,6-difluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 130848043 |
| Molecular Formula | C10H12ClF2N |
| Molecular Weight | 219.66 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 1-(4-chloro-2,6-difluorophenyl)butan-2-amine |
| SMILES | CCC(N)Cc1c(F)cc(Cl)cc1F |
| InChI | InChI=1S/C10H12ClF2N/c1-2-7(14)5-8-9(12)3-6(11)4-10(8)13/h3-4,7H,2,5,14H2,1H3 |
| InChIKey | FGQCAUBLBLFTPG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.66 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |