C10H11ClF5N — CID 170888418
1-(2,3,4,5,6-pentafluorophenyl)butan-2-amine;hydrochloride (PubChem CID 170888418) has the molecular formula C10H11ClF5N and a molecular weight of 275.65 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)butan-2-amine;hydrochloride.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170888418 |
| Molecular Formula | C10H11ClF5N |
| Molecular Weight | 275.65 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1c(F)c(F)c(F)c(F)c1F.Cl |
| InChI | InChI=1S/C10H10F5N.ClH/c1-2-4(16)3-5-6(11)8(13)10(15)9(14)7(5)12;/h4H,2-3,16H2,1H3;1H |
| InChIKey | RNGXWWCQVAYVPE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.65 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|