C9H8F5NO — CID 131370592
2-amino-3-(2,3,4,5,6-pentafluorophenyl)propan-1-ol (PubChem CID 131370592) has the molecular formula C9H8F5NO and a molecular weight of 241.16 g/mol. Its IUPAC name is 2-amino-3-(2,3,4,5,6-pentafluorophenyl)propan-1-ol.
| Compound Name | 2-amino-3-(2,3,4,5,6-pentafluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 131370592 |
| Molecular Formula | C9H8F5NO |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-amino-3-(2,3,4,5,6-pentafluorophenyl)propan-1-ol |
| SMILES | NC(CO)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H8F5NO/c10-5-4(1-3(15)2-16)6(11)8(13)9(14)7(5)12/h3,16H,1-2,15H2 |
| InChIKey | LKEXIRSNWRRFOR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|