C11H8BrF5O2 — CID 83197488
ethyl 2-bromo-3-(2,3,4,5,6-pentafluorophenyl)propanoate (PubChem CID 83197488) has the molecular formula C11H8BrF5O2 and a molecular weight of 347.08 g/mol. Its IUPAC name is ethyl 2-bromo-3-(2,3,4,5,6-pentafluorophenyl)propanoate.
| Compound Name | ethyl 2-bromo-3-(2,3,4,5,6-pentafluorophenyl)propanoate |
|---|---|
| PubChem CID | 83197488 |
| Molecular Formula | C11H8BrF5O2 |
| Molecular Weight | 347.08 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | ethyl 2-bromo-3-(2,3,4,5,6-pentafluorophenyl)propanoate |
| SMILES | CCOC(=O)C(Br)Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H8BrF5O2/c1-2-19-11(18)5(12)3-4-6(13)8(15)10(17)9(16)7(4)14/h5H,2-3H2,1H3 |
| InChIKey | XYFLAQQOJUIVIR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.08 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|