C11H10Br2F2O2 — CID 83197948
ethyl 2-bromo-3-(2-bromo-4,6-difluorophenyl)propanoate (PubChem CID 83197948) has the molecular formula C11H10Br2F2O2 and a molecular weight of 372.00 g/mol. Its IUPAC name is ethyl 2-bromo-3-(2-bromo-4,6-difluorophenyl)propanoate.
| Compound Name | ethyl 2-bromo-3-(2-bromo-4,6-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 83197948 |
| Molecular Formula | C11H10Br2F2O2 |
| Molecular Weight | 372.00 g/mol |
| Exact Mass | 369.90 |
| IUPAC Name | ethyl 2-bromo-3-(2-bromo-4,6-difluorophenyl)propanoate |
| SMILES | CCOC(=O)C(Br)Cc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C11H10Br2F2O2/c1-2-17-11(16)9(13)5-7-8(12)3-6(14)4-10(7)15/h3-4,9H,2,5H2,1H3 |
| InChIKey | XOZRQFREHWBIMC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.00 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|