C11H10ClF3O2 — CID 83197240
ethyl 2-chloro-3-(2,4,6-trifluorophenyl)propanoate (PubChem CID 83197240) has the molecular formula C11H10ClF3O2 and a molecular weight of 266.65 g/mol. Its IUPAC name is ethyl 2-chloro-3-(2,4,6-trifluorophenyl)propanoate.
| Compound Name | ethyl 2-chloro-3-(2,4,6-trifluorophenyl)propanoate |
|---|---|
| PubChem CID | 83197240 |
| Molecular Formula | C11H10ClF3O2 |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | ethyl 2-chloro-3-(2,4,6-trifluorophenyl)propanoate |
| SMILES | CCOC(=O)C(Cl)Cc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H10ClF3O2/c1-2-17-11(16)8(12)5-7-9(14)3-6(13)4-10(7)15/h3-4,8H,2,5H2,1H3 |
| InChIKey | XBTIHJXABVYYNK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|