C11H11ClF2O2 — CID 171019310
ethyl 2-[2-(chloromethyl)-3,5-difluorophenyl]acetate (PubChem CID 171019310) has the molecular formula C11H11ClF2O2 and a molecular weight of 248.66 g/mol. Its IUPAC name is ethyl 2-[2-(chloromethyl)-3,5-difluorophenyl]acetate.
| Compound Name | ethyl 2-[2-(chloromethyl)-3,5-difluorophenyl]acetate |
|---|---|
| PubChem CID | 171019310 |
| Molecular Formula | C11H11ClF2O2 |
| Molecular Weight | 248.66 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | ethyl 2-[2-(chloromethyl)-3,5-difluorophenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(F)cc(F)c1CCl |
| InChI | InChI=1S/C11H11ClF2O2/c1-2-16-11(15)4-7-3-8(13)5-10(14)9(7)6-12/h3,5H,2,4,6H2,1H3 |
| InChIKey | SIWOERVNRZNJMH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.66 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|