C11H11Cl3O2 — CID 171005942
ethyl 2-[4,5-dichloro-2-(chloromethyl)phenyl]acetate (PubChem CID 171005942) has the molecular formula C11H11Cl3O2 and a molecular weight of 281.57 g/mol. Its IUPAC name is ethyl 2-[4,5-dichloro-2-(chloromethyl)phenyl]acetate.
| Compound Name | ethyl 2-[4,5-dichloro-2-(chloromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 171005942 |
| Molecular Formula | C11H11Cl3O2 |
| Molecular Weight | 281.57 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | ethyl 2-[4,5-dichloro-2-(chloromethyl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1cc(Cl)c(Cl)cc1CCl |
| InChI | InChI=1S/C11H11Cl3O2/c1-2-16-11(15)5-7-3-9(13)10(14)4-8(7)6-12/h3-4H,2,5-6H2,1H3 |
| InChIKey | YSXXCWFXLOWPGO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|