C11H12Cl2O3 — CID 82553976
ethyl 2-(4,5-dichloro-2-methoxyphenyl)acetate (PubChem CID 82553976) has the molecular formula C11H12Cl2O3 and a molecular weight of 263.12 g/mol. Its IUPAC name is ethyl 2-(4,5-dichloro-2-methoxyphenyl)acetate.
| Compound Name | ethyl 2-(4,5-dichloro-2-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 82553976 |
| Molecular Formula | C11H12Cl2O3 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | ethyl 2-(4,5-dichloro-2-methoxyphenyl)acetate |
| SMILES | CCOC(=O)Cc1cc(Cl)c(Cl)cc1OC |
| InChI | InChI=1S/C11H12Cl2O3/c1-3-16-11(14)5-7-4-8(12)9(13)6-10(7)15-2/h4,6H,3,5H2,1-2H3 |
| InChIKey | LOAAQPHRMWVLAD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |