C16H16F4O5 — CID 54490655
diethyl 2-(2-ethyl-3,4,5,6-tetrafluorobenzoyl)propanedioate (PubChem CID 54490655) has the molecular formula C16H16F4O5 and a molecular weight of 364.29 g/mol. Its IUPAC name is diethyl 2-(2-ethyl-3,4,5,6-tetrafluorobenzoyl)propanedioate.
| Compound Name | diethyl 2-(2-ethyl-3,4,5,6-tetrafluorobenzoyl)propanedioate |
|---|---|
| PubChem CID | 54490655 |
| Molecular Formula | C16H16F4O5 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | diethyl 2-(2-ethyl-3,4,5,6-tetrafluorobenzoyl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(=O)c1c(F)c(F)c(F)c(F)c1CC |
| InChI | InChI=1S/C16H16F4O5/c1-4-7-8(11(18)13(20)12(19)10(7)17)14(21)9(15(22)24-5-2)16(23)25-6-3/h9H,4-6H2,1-3H3 |
| InChIKey | XVMKFVTUSKQSLY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|