C15H18F4O2 — CID 138702503
2-methylpropyl 3-(2-ethyl-3,4,5,6-tetrafluorophenyl)propanoate (PubChem CID 138702503) has the molecular formula C15H18F4O2 and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-methylpropyl 3-(2-ethyl-3,4,5,6-tetrafluorophenyl)propanoate.
| Compound Name | 2-methylpropyl 3-(2-ethyl-3,4,5,6-tetrafluorophenyl)propanoate |
|---|---|
| PubChem CID | 138702503 |
| Molecular Formula | C15H18F4O2 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-methylpropyl 3-(2-ethyl-3,4,5,6-tetrafluorophenyl)propanoate |
| SMILES | CCc1c(F)c(F)c(F)c(F)c1CCC(=O)OCC(C)C |
| InChI | InChI=1S/C15H18F4O2/c1-4-9-10(5-6-11(20)21-7-8(2)3)13(17)15(19)14(18)12(9)16/h8H,4-7H2,1-3H3 |
| InChIKey | FJCDKWJKALAQIM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|