C15H17F3O4 — CID 91719011
4-O-(2-methylpropyl) 1-O-[(2,4,5-trifluorophenyl)methyl] butanedioate (PubChem CID 91719011) has the molecular formula C15H17F3O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is 4-O-(2-methylpropyl) 1-O-[(2,4,5-trifluorophenyl)methyl] butanedioate.
| Compound Name | 4-O-(2-methylpropyl) 1-O-[(2,4,5-trifluorophenyl)methyl] butanedioate |
|---|---|
| PubChem CID | 91719011 |
| Molecular Formula | C15H17F3O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 4-O-(2-methylpropyl) 1-O-[(2,4,5-trifluorophenyl)methyl] butanedioate |
| SMILES | CC(C)COC(=O)CCC(=O)OCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H17F3O4/c1-9(2)7-21-14(19)3-4-15(20)22-8-10-5-12(17)13(18)6-11(10)16/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | YHYKXSBUUXQMPP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|