About 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate
1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate (PubChem CID 91702744) has the molecular formula C15H18ClNO6
and a molecular weight of 343.76 g/mol. Its IUPAC name is 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate.
Molecular Properties
| Compound Name | 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate |
| PubChem CID | 91702744 |
| Molecular Formula | C15H18ClNO6 |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate |
| SMILES | CC(C)COC(=O)CCC(=O)OCc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18ClNO6/c1-10(2)8-22-14(18)5-6-15(19)23-9-11-3-4-12(16)7-13(11)17(20)21/h3-4,7,10H,5-6,8-9H2,1-2H3 |
| InChIKey | DIMOVBVWYIYWOU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate?
The IUPAC name of 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate (CID 91702744) is 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate.
What is the SMILES notation for 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate?
The canonical SMILES for 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate is CC(C)COC(=O)CCC(=O)OCc1ccc(Cl)cc1[N+](=O)[O-].
What is the InChIKey of 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate?
The InChIKey is DIMOVBVWYIYWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClNO6/c1-10(2)8-22-14(18)5-6-15(19)23-9-11-3-4-12(16)7-13(11)17(20)21/h3-4,7,10H,5-6,8-9H2,1-2H3.
What are the key properties of 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate?
1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate has a molecular weight of 343.76 g/mol, XLogP of 3.27, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[(4-chloro-2-nitrophenyl)methyl] 4-O-(2-methylpropyl) butanedioate is sourced from PubChem (CID 91702744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).