C15H14Cl3NO4 — CID 134116443
(4-chloro-2-nitrophenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 134116443) has the molecular formula C15H14Cl3NO4 and a molecular weight of 378.64 g/mol. Its IUPAC name is (4-chloro-2-nitrophenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (4-chloro-2-nitrophenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134116443 |
| Molecular Formula | C15H14Cl3NO4 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | (4-chloro-2-nitrophenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OCc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14Cl3NO4/c1-15(2)10(6-12(17)18)13(15)14(20)23-7-8-3-4-9(16)5-11(8)19(21)22/h3-6,10,13H,7H2,1-2H3 |
| InChIKey | RXHHEXPPRIFSMN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|