C13H11F5O3 — CID 12687559
ethyl 2,2-dimethyl-3-oxo-3-(2,3,4,5,6-pentafluorophenyl)propanoate (PubChem CID 12687559) has the molecular formula C13H11F5O3 and a molecular weight of 310.22 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-3-oxo-3-(2,3,4,5,6-pentafluorophenyl)propanoate.
| Compound Name | ethyl 2,2-dimethyl-3-oxo-3-(2,3,4,5,6-pentafluorophenyl)propanoate |
|---|---|
| PubChem CID | 12687559 |
| Molecular Formula | C13H11F5O3 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | ethyl 2,2-dimethyl-3-oxo-3-(2,3,4,5,6-pentafluorophenyl)propanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H11F5O3/c1-4-21-12(20)13(2,3)11(19)5-6(14)8(16)10(18)9(17)7(5)15/h4H2,1-3H3 |
| InChIKey | KRIOBJQMWRBCFV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|