C14H12F5NO2 — CID 117049634
ethyl 4-cyano-2-methyl-2-(2,3,4,5,6-pentafluorophenyl)butanoate (PubChem CID 117049634) has the molecular formula C14H12F5NO2 and a molecular weight of 321.25 g/mol. Its IUPAC name is ethyl 4-cyano-2-methyl-2-(2,3,4,5,6-pentafluorophenyl)butanoate.
| Compound Name | ethyl 4-cyano-2-methyl-2-(2,3,4,5,6-pentafluorophenyl)butanoate |
|---|---|
| PubChem CID | 117049634 |
| Molecular Formula | C14H12F5NO2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | ethyl 4-cyano-2-methyl-2-(2,3,4,5,6-pentafluorophenyl)butanoate |
| SMILES | CCOC(=O)C(C)(CCC#N)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H12F5NO2/c1-3-22-13(21)14(2,5-4-6-20)7-8(15)10(17)12(19)11(18)9(7)16/h3-5H2,1-2H3 |
| InChIKey | QAOFSSWRGFMFFE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|