C14H15F2NO2 — CID 117049641
ethyl 4-cyano-2-(2,4-difluorophenyl)-2-methylbutanoate (PubChem CID 117049641) has the molecular formula C14H15F2NO2 and a molecular weight of 267.27 g/mol. Its IUPAC name is ethyl 4-cyano-2-(2,4-difluorophenyl)-2-methylbutanoate.
| Compound Name | ethyl 4-cyano-2-(2,4-difluorophenyl)-2-methylbutanoate |
|---|---|
| PubChem CID | 117049641 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl 4-cyano-2-(2,4-difluorophenyl)-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)(CCC#N)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H15F2NO2/c1-3-19-13(18)14(2,7-4-8-17)11-6-5-10(15)9-12(11)16/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | CBUSUZHINGSQHV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |