C12H15F2NO2 — CID 67025344
ethyl (3S)-3-amino-3-(2,4-difluorophenyl)butanoate (PubChem CID 67025344) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(2,4-difluorophenyl)butanoate.
| Compound Name | ethyl (3S)-3-amino-3-(2,4-difluorophenyl)butanoate |
|---|---|
| PubChem CID | 67025344 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | ethyl (3S)-3-amino-3-(2,4-difluorophenyl)butanoate |
| SMILES | CCOC(=O)C[C@](C)(N)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H15F2NO2/c1-3-17-11(16)7-12(2,15)9-5-4-8(13)6-10(9)14/h4-6H,3,7,15H2,1-2H3/t12-/m0/s1 |
| InChIKey | OOYFSDACOXWTCM-LBPRGKRZSA-N |
| XLogP | 2.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |