C14H15F2NO2 — CID 62364969
ethyl 2-(2,4-difluorophenyl)-2-(prop-2-ynylamino)propanoate (PubChem CID 62364969) has the molecular formula C14H15F2NO2 and a molecular weight of 267.27 g/mol. Its IUPAC name is ethyl 2-(2,4-difluorophenyl)-2-(prop-2-ynylamino)propanoate.
| Compound Name | ethyl 2-(2,4-difluorophenyl)-2-(prop-2-ynylamino)propanoate |
|---|---|
| PubChem CID | 62364969 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl 2-(2,4-difluorophenyl)-2-(prop-2-ynylamino)propanoate |
| SMILES | C#CCNC(C)(C(=O)OCC)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H15F2NO2/c1-4-8-17-14(3,13(18)19-5-2)11-7-6-10(15)9-12(11)16/h1,6-7,9,17H,5,8H2,2-3H3 |
| InChIKey | CZGLBEDMZAWWHL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|