C16H21NO2 — CID 55063389
ethyl 2-(2,5-dimethylphenyl)-2-(prop-2-ynylamino)propanoate (PubChem CID 55063389) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is ethyl 2-(2,5-dimethylphenyl)-2-(prop-2-ynylamino)propanoate.
| Compound Name | ethyl 2-(2,5-dimethylphenyl)-2-(prop-2-ynylamino)propanoate |
|---|---|
| PubChem CID | 55063389 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | ethyl 2-(2,5-dimethylphenyl)-2-(prop-2-ynylamino)propanoate |
| SMILES | C#CCNC(C)(C(=O)OCC)c1cc(C)ccc1C |
| InChI | InChI=1S/C16H21NO2/c1-6-10-17-16(5,15(18)19-7-2)14-11-12(3)8-9-13(14)4/h1,8-9,11,17H,7,10H2,2-5H3 |
| InChIKey | XBXGNIFJOKWBKQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|