C14H16BrNO2 — CID 62367212
ethyl 2-(3-bromophenyl)-2-(prop-2-ynylamino)propanoate (PubChem CID 62367212) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is ethyl 2-(3-bromophenyl)-2-(prop-2-ynylamino)propanoate.
| Compound Name | ethyl 2-(3-bromophenyl)-2-(prop-2-ynylamino)propanoate |
|---|---|
| PubChem CID | 62367212 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | ethyl 2-(3-bromophenyl)-2-(prop-2-ynylamino)propanoate |
| SMILES | C#CCNC(C)(C(=O)OCC)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H16BrNO2/c1-4-9-16-14(3,13(17)18-5-2)11-7-6-8-12(15)10-11/h1,6-8,10,16H,5,9H2,2-3H3 |
| InChIKey | FUBWMIQCPFRUSI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|