C16H16BrNO3 — CID 62365474
ethyl 2-(5-bromo-1-benzofuran-2-yl)-2-(prop-2-ynylamino)propanoate (PubChem CID 62365474) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is ethyl 2-(5-bromo-1-benzofuran-2-yl)-2-(prop-2-ynylamino)propanoate.
| Compound Name | ethyl 2-(5-bromo-1-benzofuran-2-yl)-2-(prop-2-ynylamino)propanoate |
|---|---|
| PubChem CID | 62365474 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | ethyl 2-(5-bromo-1-benzofuran-2-yl)-2-(prop-2-ynylamino)propanoate |
| SMILES | C#CCNC(C)(C(=O)OCC)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C16H16BrNO3/c1-4-8-18-16(3,15(19)20-5-2)14-10-11-9-12(17)6-7-13(11)21-14/h1,6-7,9-10,18H,5,8H2,2-3H3 |
| InChIKey | IYBCIRWAEONHRL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|