C13H17F2NO2 — CID 117049865
ethyl 4-amino-2-(2,4-difluorophenyl)-2-methylbutanoate (PubChem CID 117049865) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is ethyl 4-amino-2-(2,4-difluorophenyl)-2-methylbutanoate.
| Compound Name | ethyl 4-amino-2-(2,4-difluorophenyl)-2-methylbutanoate |
|---|---|
| PubChem CID | 117049865 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | ethyl 4-amino-2-(2,4-difluorophenyl)-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)(CCN)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H17F2NO2/c1-3-18-12(17)13(2,6-7-16)10-5-4-9(14)8-11(10)15/h4-5,8H,3,6-7,16H2,1-2H3 |
| InChIKey | WXAQUGXORZSFEM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |