C14H19F2NO2 — CID 66097553
methyl 4-amino-3-(2,4-difluorophenyl)-3,4-dimethylpentanoate (PubChem CID 66097553) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is methyl 4-amino-3-(2,4-difluorophenyl)-3,4-dimethylpentanoate.
| Compound Name | methyl 4-amino-3-(2,4-difluorophenyl)-3,4-dimethylpentanoate |
|---|---|
| PubChem CID | 66097553 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | methyl 4-amino-3-(2,4-difluorophenyl)-3,4-dimethylpentanoate |
| SMILES | COC(=O)CC(C)(c1ccc(F)cc1F)C(C)(C)N |
| InChI | InChI=1S/C14H19F2NO2/c1-13(2,17)14(3,8-12(18)19-4)10-6-5-9(15)7-11(10)16/h5-7H,8,17H2,1-4H3 |
| InChIKey | IXPRXEDYXLSYNH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |