C11H13F2NO2 — CID 60787394
methyl 2-(2,4-difluorophenyl)-2-(methylamino)propanoate (PubChem CID 60787394) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is methyl 2-(2,4-difluorophenyl)-2-(methylamino)propanoate.
| Compound Name | methyl 2-(2,4-difluorophenyl)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 60787394 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | methyl 2-(2,4-difluorophenyl)-2-(methylamino)propanoate |
| SMILES | CNC(C)(C(=O)OC)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H13F2NO2/c1-11(14-2,10(15)16-3)8-5-4-7(12)6-9(8)13/h4-6,14H,1-3H3 |
| InChIKey | QMUDIALXHDZAMD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |