C14H13F2NO2 — CID 91501243
methyl 2-(2,4-difluorophenyl)-2-(1H-pyrrol-2-yl)propanoate (PubChem CID 91501243) has the molecular formula C14H13F2NO2 and a molecular weight of 265.26 g/mol. Its IUPAC name is methyl 2-(2,4-difluorophenyl)-2-(1H-pyrrol-2-yl)propanoate.
| Compound Name | methyl 2-(2,4-difluorophenyl)-2-(1H-pyrrol-2-yl)propanoate |
|---|---|
| PubChem CID | 91501243 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | methyl 2-(2,4-difluorophenyl)-2-(1H-pyrrol-2-yl)propanoate |
| SMILES | COC(=O)C(C)(c1ccc[nH]1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H13F2NO2/c1-14(13(18)19-2,12-4-3-7-17-12)10-6-5-9(15)8-11(10)16/h3-8,17H,1-2H3 |
| InChIKey | BKCYFSMJSRELTG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |