C22H28N4O8 — CID 87552469
2,2-bis(2-cyanoethyl)propanedioic acid;diethyl 2,2-bis(2-cyanoethyl)propanedioate (PubChem CID 87552469) has the molecular formula C22H28N4O8 and a molecular weight of 476.49 g/mol. Its IUPAC name is 2,2-bis(2-cyanoethyl)propanedioic acid;diethyl 2,2-bis(2-cyanoethyl)propanedioate.
| Compound Name | 2,2-bis(2-cyanoethyl)propanedioic acid;diethyl 2,2-bis(2-cyanoethyl)propanedioate |
|---|---|
| PubChem CID | 87552469 |
| Molecular Formula | C22H28N4O8 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2,2-bis(2-cyanoethyl)propanedioic acid;diethyl 2,2-bis(2-cyanoethyl)propanedioate |
| SMILES | CCOC(=O)C(CCC#N)(CCC#N)C(=O)OCC.N#CCCC(CCC#N)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H18N2O4.C9H10N2O4/c1-3-18-11(16)13(7-5-9-14,8-6-10-15)12(17)19-4-2;10-5-1-3-9(7(12)13,8(14)15)4-2-6-11/h3-8H2,1-2H3;1-4H2,(H,12,13)(H,14,15) |
| InChIKey | WMMCUBNNCAJLQB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 222.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|