C27H48O8 — CID 134314067
tetraethyl pentadecane-4,4,10,10-tetracarboxylate (PubChem CID 134314067) has the molecular formula C27H48O8 and a molecular weight of 500.67 g/mol. Its IUPAC name is tetraethyl pentadecane-4,4,10,10-tetracarboxylate.
| Compound Name | tetraethyl pentadecane-4,4,10,10-tetracarboxylate |
|---|---|
| PubChem CID | 134314067 |
| Molecular Formula | C27H48O8 |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | tetraethyl pentadecane-4,4,10,10-tetracarboxylate |
| SMILES | CCCCC(CCCCCC(CCCC)(C(=O)OCC)C(=O)OCC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C27H48O8/c1-7-13-18-26(22(28)32-9-3,23(29)33-10-4)20-16-15-17-21-27(19-14-8-2,24(30)34-11-5)25(31)35-12-6/h7-21H2,1-6H3 |
| InChIKey | FHNWZUMRQXRQHC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|