C20H33F5O4 — CID 59110056
diethyl 2-octyl-2-(4,4,5,5,5-pentafluoropentyl)propanedioate (PubChem CID 59110056) has the molecular formula C20H33F5O4 and a molecular weight of 432.47 g/mol. Its IUPAC name is diethyl 2-octyl-2-(4,4,5,5,5-pentafluoropentyl)propanedioate.
| Compound Name | diethyl 2-octyl-2-(4,4,5,5,5-pentafluoropentyl)propanedioate |
|---|---|
| PubChem CID | 59110056 |
| Molecular Formula | C20H33F5O4 |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | diethyl 2-octyl-2-(4,4,5,5,5-pentafluoropentyl)propanedioate |
| SMILES | CCCCCCCCC(CCCC(F)(F)C(F)(F)F)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H33F5O4/c1-4-7-8-9-10-11-13-18(16(26)28-5-2,17(27)29-6-3)14-12-15-19(21,22)20(23,24)25/h4-15H2,1-3H3 |
| InChIKey | STEOOCCLJLEBSM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|