C14H20BrF5O4 — CID 22033144
diethyl 2-(2-bromoethyl)-2-(4,4,5,5,5-pentafluoropentyl)propanedioate (PubChem CID 22033144) has the molecular formula C14H20BrF5O4 and a molecular weight of 427.20 g/mol. Its IUPAC name is diethyl 2-(2-bromoethyl)-2-(4,4,5,5,5-pentafluoropentyl)propanedioate.
| Compound Name | diethyl 2-(2-bromoethyl)-2-(4,4,5,5,5-pentafluoropentyl)propanedioate |
|---|---|
| PubChem CID | 22033144 |
| Molecular Formula | C14H20BrF5O4 |
| Molecular Weight | 427.20 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | diethyl 2-(2-bromoethyl)-2-(4,4,5,5,5-pentafluoropentyl)propanedioate |
| SMILES | CCOC(=O)C(CCBr)(CCCC(F)(F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C14H20BrF5O4/c1-3-23-10(21)12(8-9-15,11(22)24-4-2)6-5-7-13(16,17)14(18,19)20/h3-9H2,1-2H3 |
| InChIKey | RWLMZEAHWWEHJG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|